UserName
CAS: 50-07-7 Molecular Formula: C15H18N4O5 Molecular Weight (g/mol): 334.332 InChI Key: NWIBSHFKIJFRCO-WUDYKRTCSA-N Synonym: mitomycin c,mitomycin,ametycine,mutamycin,ametycin,mitocin-c,mitomycinum,mytomycin,mytozytrex,mitomycin-c PubChem CID: 5746 ChEBI: CHEBI:27504 SMILES: CC1=C(C(=O)C2=C(C1=O)N3CC4C(C3(C2COC(=O)N)OC)N4)N
PubChem CID | 5746 |
---|---|
CAS | 50-07-7 |
Molecular Weight (g/mol) | 334.332 |
ChEBI | CHEBI:27504 |
SMILES | CC1=C(C(=O)C2=C(C1=O)N3CC4C(C3(C2COC(=O)N)OC)N4)N |
Synonym | mitomycin c,mitomycin,ametycine,mutamycin,ametycin,mitocin-c,mitomycinum,mytomycin,mytozytrex,mitomycin-c |
InChI Key | NWIBSHFKIJFRCO-WUDYKRTCSA-N |
Molecular Formula | C15H18N4O5 |
Mitomycin C, CAS # 50-07-7, is a methylazirinopyrroloindoledione complex isolated from the bacterium Streptomyces caespitosus and other Streptomyces bacterial species. It is a versatile and potent compound with antibiotic activity and may have potential therapeutic value in the treatment of cancer.